C21H34IN5O — CID 111414382
N,N-dimethyl-2-[[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide (PubChem CID 111414382) has the molecular formula C21H34IN5O and a molecular weight of 499.44 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide.
| Compound Name | N,N-dimethyl-2-[[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111414382 |
| Molecular Formula | C21H34IN5O |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.18 |
| IUPAC Name | N,N-dimethyl-2-[[[methyl-[(4-piperidin-1-ylphenyl)methyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide;hydroiodide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)N(C)Cc1ccc(N2CCCCC2)cc1.I |
| InChI | InChI=1S/C21H33N5O.HI/c1-5-13-22-21(23-16-20(27)24(2)3)25(4)17-18-9-11-19(12-10-18)26-14-7-6-8-15-26;/h5,9-12H,1,6-8,13-17H2,2-4H3,(H,22,23);1H |
| InChIKey | IXNAYXOFRIARRO-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|