C21H34N6O — CID 110049598
N,N-dimethyl-2-[[[methyl-[2-(1-pyridin-4-ylpiperidin-4-yl)ethyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide (PubChem CID 110049598) has the molecular formula C21H34N6O and a molecular weight of 386.54 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[methyl-[2-(1-pyridin-4-ylpiperidin-4-yl)ethyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[methyl-[2-(1-pyridin-4-ylpiperidin-4-yl)ethyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110049598 |
| Molecular Formula | C21H34N6O |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.28 |
| IUPAC Name | N,N-dimethyl-2-[[[methyl-[2-(1-pyridin-4-ylpiperidin-4-yl)ethyl]amino]-(prop-2-enylamino)methylidene]amino]acetamide |
| SMILES | C=CCN/C(=N\CC(=O)N(C)C)N(C)CCC1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C21H34N6O/c1-5-11-23-21(24-17-20(28)25(2)3)26(4)14-8-18-9-15-27(16-10-18)19-6-12-22-13-7-19/h5-7,12-13,18H,1,8-11,14-17H2,2-4H3,(H,23,24) |
| InChIKey | YHSXJPDZZMDMPY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|