C20H29IN8 — CID 111519484
3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111519484) has the molecular formula C20H29IN8 and a molecular weight of 508.41 g/mol. Its IUPAC name is 3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111519484 |
| Molecular Formula | C20H29IN8 |
| Molecular Weight | 508.41 g/mol |
| Exact Mass | 508.16 |
| IUPAC Name | 3-ethyl-2-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCn1cnnc1CC)N(C)Cc1cnn(-c2ccccc2)c1.I |
| InChI | InChI=1S/C20H28N8.HI/c1-4-19-25-23-16-27(19)12-11-22-20(21-5-2)26(3)14-17-13-24-28(15-17)18-9-7-6-8-10-18;/h6-10,13,15-16H,4-5,11-12,14H2,1-3H3,(H,21,22);1H |
| InChIKey | ORRVFNQPIJPRTQ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|