C21H31IN8 — CID 111414614
3-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide (PubChem CID 111414614) has the molecular formula C21H31IN8 and a molecular weight of 522.44 g/mol. Its IUPAC name is 3-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide.
| Compound Name | 3-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111414614 |
| Molecular Formula | C21H31IN8 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 522.17 |
| IUPAC Name | 3-butyl-2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(=N\Cc1nnc(C)n1C)N(C)Cc1cnn(-c2ccccc2)c1.I |
| InChI | InChI=1S/C21H30N8.HI/c1-5-6-12-22-21(23-14-20-26-25-17(2)28(20)4)27(3)15-18-13-24-29(16-18)19-10-8-7-9-11-19;/h7-11,13,16H,5-6,12,14-15H2,1-4H3,(H,22,23);1H |
| InChIKey | XQNDOTQRZBHMMA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|