C20H26N8 — CID 111414613
2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-prop-2-enylguanidine (PubChem CID 111414613) has the molecular formula C20H26N8 and a molecular weight of 378.48 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-prop-2-enylguanidine.
| Compound Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-prop-2-enylguanidine |
|---|---|
| PubChem CID | 111414613 |
| Molecular Formula | C20H26N8 |
| Molecular Weight | 378.48 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 2-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-1-methyl-1-[(1-phenylpyrazol-4-yl)methyl]-3-prop-2-enylguanidine |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)N(C)Cc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C20H26N8/c1-5-11-21-20(22-13-19-25-24-16(2)27(19)4)26(3)14-17-12-23-28(15-17)18-9-7-6-8-10-18/h5-10,12,15H,1,11,13-14H2,2-4H3,(H,21,22) |
| InChIKey | BTQVRKOCHKLRNF-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 76.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.48 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|