C16H30IN7O — CID 111009724
2-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide (PubChem CID 111009724) has the molecular formula C16H30IN7O and a molecular weight of 463.37 g/mol. Its IUPAC name is 2-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide.
| Compound Name | 2-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111009724 |
| Molecular Formula | C16H30IN7O |
| Molecular Weight | 463.37 g/mol |
| Exact Mass | 463.16 |
| IUPAC Name | 2-[[N'-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-N-prop-2-enylcarbamimidoyl]-methylamino]-N,N-diethylacetamide;hydroiodide |
| SMILES | C=CCN/C(=N\Cc1nnc(C)n1C)N(C)CC(=O)N(CC)CC.I |
| InChI | InChI=1S/C16H29N7O.HI/c1-7-10-17-16(18-11-14-20-19-13(4)22(14)6)21(5)12-15(24)23(8-2)9-3;/h7H,1,8-12H2,2-6H3,(H,17,18);1H |
| InChIKey | DEVWZEVMSOHAKG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 78.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.37 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|