C22H32FN7O — CID 136923689
N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide (PubChem CID 136923689) has the molecular formula C22H32FN7O and a molecular weight of 429.54 g/mol. Its IUPAC name is N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide.
| Compound Name | N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 136923689 |
| Molecular Formula | C22H32FN7O |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.27 |
| IUPAC Name | N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-[(3-fluoro-4-methoxyphenyl)methyl]-N-prop-2-enylpiperazine-1-carboximidamide |
| SMILES | C=CCN/C(=N\CCn1cnnc1CC)N1CCN(Cc2ccc(OC)c(F)c2)CC1 |
| InChI | InChI=1S/C22H32FN7O/c1-4-8-24-22(25-9-10-30-17-26-27-21(30)5-2)29-13-11-28(12-14-29)16-18-6-7-20(31-3)19(23)15-18/h4,6-7,15,17H,1,5,8-14,16H2,2-3H3,(H,24,25) |
| InChIKey | UWQKYYVBGOLANS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 70.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|