C20H29ClFN7 — CID 111517063
4-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide (PubChem CID 111517063) has the molecular formula C20H29ClFN7 and a molecular weight of 421.95 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111517063 |
| Molecular Formula | C20H29ClFN7 |
| Molecular Weight | 421.95 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methyl]-N-ethyl-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]piperazine-1-carboximidamide |
| SMILES | CCN/C(=N\CCn1cnnc1CC)N1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C20H29ClFN7/c1-3-19-26-25-15-29(19)9-8-24-20(23-4-2)28-12-10-27(11-13-28)14-16-17(21)6-5-7-18(16)22/h5-7,15H,3-4,8-14H2,1-2H3,(H,23,24) |
| InChIKey | XABVTFAHLQIVNV-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.95 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|