C21H29ClFN7 — CID 136923673
4-[(2-chloro-6-fluorophenyl)methyl]-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide (PubChem CID 136923673) has the molecular formula C21H29ClFN7 and a molecular weight of 433.96 g/mol. Its IUPAC name is 4-[(2-chloro-6-fluorophenyl)methyl]-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide.
| Compound Name | 4-[(2-chloro-6-fluorophenyl)methyl]-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 136923673 |
| Molecular Formula | C21H29ClFN7 |
| Molecular Weight | 433.96 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 4-[(2-chloro-6-fluorophenyl)methyl]-N'-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N-prop-2-enylpiperazine-1-carboximidamide |
| SMILES | C=CCN/C(=N\CCn1cnnc1CC)N1CCN(Cc2c(F)cccc2Cl)CC1 |
| InChI | InChI=1S/C21H29ClFN7/c1-3-8-24-21(25-9-10-30-16-26-27-20(30)4-2)29-13-11-28(12-14-29)15-17-18(22)6-5-7-19(17)23/h3,5-7,16H,1,4,8-15H2,2H3,(H,24,25) |
| InChIKey | UWYOUXJVPSYMCO-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.96 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|