C19H26Cl2N6 — CID 111546469
N'-[2-(2,4-dichlorophenyl)ethyl]-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]pyrrolidine-1-carboximidamide (PubChem CID 111546469) has the molecular formula C19H26Cl2N6 and a molecular weight of 409.37 g/mol. Its IUPAC name is N'-[2-(2,4-dichlorophenyl)ethyl]-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]pyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(2,4-dichlorophenyl)ethyl]-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]pyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111546469 |
| Molecular Formula | C19H26Cl2N6 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 408.16 |
| IUPAC Name | N'-[2-(2,4-dichlorophenyl)ethyl]-N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]pyrrolidine-1-carboximidamide |
| SMILES | CCc1nncn1CCN/C(=N\CCc1ccc(Cl)cc1Cl)N1CCCC1 |
| InChI | InChI=1S/C19H26Cl2N6/c1-2-18-25-24-14-27(18)12-9-23-19(26-10-3-4-11-26)22-8-7-15-5-6-16(20)13-17(15)21/h5-6,13-14H,2-4,7-12H2,1H3,(H,22,23) |
| InChIKey | OAGSMJXVCRWRHH-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|