C12H22N6 — CID 111465836
N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide (PubChem CID 111465836) has the molecular formula C12H22N6 and a molecular weight of 250.35 g/mol. Its IUPAC name is N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide.
| Compound Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111465836 |
| Molecular Formula | C12H22N6 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.19 |
| IUPAC Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-methylpyrrolidine-1-carboximidamide |
| SMILES | CCc1nncn1CCN/C(=N/C)N1CCCC1 |
| InChI | InChI=1S/C12H22N6/c1-3-11-16-15-10-18(11)9-6-14-12(13-2)17-7-4-5-8-17/h10H,3-9H2,1-2H3,(H,13,14) |
| InChIKey | RDPCAXYDDLPJFG-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|