C18H26FN7 — CID 111510877
N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide (PubChem CID 111510877) has the molecular formula C18H26FN7 and a molecular weight of 359.45 g/mol. Its IUPAC name is N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide.
| Compound Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111510877 |
| Molecular Formula | C18H26FN7 |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.22 |
| IUPAC Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-fluorophenyl)-N'-methylpiperazine-1-carboximidamide |
| SMILES | CCc1nncn1CCN/C(=N\C)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C18H26FN7/c1-3-17-23-22-14-26(17)9-8-21-18(20-2)25-12-10-24(11-13-25)16-7-5-4-6-15(16)19/h4-7,14H,3,8-13H2,1-2H3,(H,20,21) |
| InChIKey | UXLFAAFEXGJUMH-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|