C22H28FN7S — CID 111510907
N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-fluorophenyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide (PubChem CID 111510907) has the molecular formula C22H28FN7S and a molecular weight of 441.58 g/mol. Its IUPAC name is N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-fluorophenyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide.
| Compound Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-fluorophenyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111510907 |
| Molecular Formula | C22H28FN7S |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-4-(2-fluorophenyl)-N'-(thiophen-2-ylmethyl)piperazine-1-carboximidamide |
| SMILES | CCc1nncn1CCN/C(=N\Cc1cccs1)N1CCN(c2ccccc2F)CC1 |
| InChI | InChI=1S/C22H28FN7S/c1-2-21-27-26-17-30(21)10-9-24-22(25-16-18-6-5-15-31-18)29-13-11-28(12-14-29)20-8-4-3-7-19(20)23/h3-8,15,17H,2,9-14,16H2,1H3,(H,24,25) |
| InChIKey | YKLWZGNEILBOLX-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 61.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|