C22H28N6S — CID 111492296
N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-thiophen-2-ylethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide (PubChem CID 111492296) has the molecular formula C22H28N6S and a molecular weight of 408.58 g/mol. Its IUPAC name is N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-thiophen-2-ylethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide.
| Compound Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-thiophen-2-ylethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
|---|---|
| PubChem CID | 111492296 |
| Molecular Formula | C22H28N6S |
| Molecular Weight | 408.58 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-thiophen-2-ylethyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide |
| SMILES | CCc1nncn1CCN/C(=N\CCc1cccs1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H28N6S/c1-2-21-26-25-17-28(21)14-12-24-22(23-11-9-20-8-5-15-29-20)27-13-10-18-6-3-4-7-19(18)16-27/h3-8,15,17H,2,9-14,16H2,1H3,(H,23,24) |
| InChIKey | SHTIZPALAABVSF-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.58 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|