C22H35N7 — CID 111700759
1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methylbutyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine (PubChem CID 111700759) has the molecular formula C22H35N7 and a molecular weight of 397.57 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methylbutyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methylbutyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111700759 |
| Molecular Formula | C22H35N7 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | 1-[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-methylbutyl]-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-methylguanidine |
| SMILES | CCc1nncn1CCN/C(=N\C)NCC(C(C)C)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C22H35N7/c1-5-21-27-26-16-29(21)13-11-24-22(23-4)25-14-20(17(2)3)28-12-10-18-8-6-7-9-19(18)15-28/h6-9,16-17,20H,5,10-15H2,1-4H3,(H2,23,24,25) |
| InChIKey | XPMIPWIAPKUTPK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|