C20H31IN6 — CID 111492367
N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-methylpropyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide (PubChem CID 111492367) has the molecular formula C20H31IN6 and a molecular weight of 482.41 g/mol. Its IUPAC name is N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-methylpropyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide.
| Compound Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-methylpropyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111492367 |
| Molecular Formula | C20H31IN6 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 482.17 |
| IUPAC Name | N-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-N'-(2-methylpropyl)-3,4-dihydro-1H-isoquinoline-2-carboximidamide;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\CC(C)C)N1CCc2ccccc2C1.I |
| InChI | InChI=1S/C20H30N6.HI/c1-4-19-24-23-15-26(19)12-10-21-20(22-13-16(2)3)25-11-9-17-7-5-6-8-18(17)14-25;/h5-8,15-16H,4,9-14H2,1-3H3,(H,21,22);1H |
| InChIKey | XWKIKYJGNXQSHU-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|