C11H23IN6 — CID 111822187
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 111822187) has the molecular formula C11H23IN6 and a molecular weight of 366.25 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111822187 |
| Molecular Formula | C11H23IN6 |
| Molecular Weight | 366.25 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(N)=N/CC(C)C.I |
| InChI | InChI=1S/C11H22N6.HI/c1-4-10-16-15-8-17(10)6-5-13-11(12)14-7-9(2)3;/h8-9H,4-7H2,1-3H3,(H3,12,13,14);1H |
| InChIKey | ISQSLNQRQSIJIZ-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 81.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.25 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|