C12H23IN6O — CID 111465829
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111465829) has the molecular formula C12H23IN6O and a molecular weight of 394.26 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111465829 |
| Molecular Formula | C12H23IN6O |
| Molecular Weight | 394.26 g/mol |
| Exact Mass | 394.10 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(oxolan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(N)=N/CC1CCCO1.I |
| InChI | InChI=1S/C12H22N6O.HI/c1-2-11-17-16-9-18(11)6-5-14-12(13)15-8-10-4-3-7-19-10;/h9-10H,2-8H2,1H3,(H3,13,14,15);1H |
| InChIKey | JUOKEVPCBJFZRY-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 90.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.26 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|