C19H27BrN6O — CID 111977794
2-[(4-bromophenyl)methyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine (PubChem CID 111977794) has the molecular formula C19H27BrN6O and a molecular weight of 435.37 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 2-[(4-bromophenyl)methyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111977794 |
| Molecular Formula | C19H27BrN6O |
| Molecular Weight | 435.37 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(oxolan-2-ylmethyl)guanidine |
| SMILES | CCc1nncn1CCN/C(=N\Cc1ccc(Br)cc1)NCC1CCCO1 |
| InChI | InChI=1S/C19H27BrN6O/c1-2-18-25-24-14-26(18)10-9-21-19(23-13-17-4-3-11-27-17)22-12-15-5-7-16(20)8-6-15/h5-8,14,17H,2-4,9-13H2,1H3,(H2,21,22,23) |
| InChIKey | KPTPATFXQKFQLY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 76.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.37 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|