C23H38IN7O2 — CID 110020632
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-(oxan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110020632) has the molecular formula C23H38IN7O2 and a molecular weight of 571.51 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-(oxan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-(oxan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110020632 |
| Molecular Formula | C23H38IN7O2 |
| Molecular Weight | 571.51 g/mol |
| Exact Mass | 571.21 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]-3-(oxan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\CC(c1ccco1)N1CCCC1)NCC1CCCCO1.I |
| InChI | InChI=1S/C23H37N7O2.HI/c1-2-22-28-27-18-30(22)13-10-24-23(25-16-19-8-3-6-14-31-19)26-17-20(21-9-7-15-32-21)29-11-4-5-12-29;/h7,9,15,18-20H,2-6,8,10-14,16-17H2,1H3,(H2,24,25,26);1H |
| InChIKey | CBSFDJNKEBYIRV-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 92.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.51 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|