C23H37N7O — CID 111510019
1-cyclohexyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine (PubChem CID 111510019) has the molecular formula C23H37N7O and a molecular weight of 427.60 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine.
| Compound Name | 1-cyclohexyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine |
|---|---|
| PubChem CID | 111510019 |
| Molecular Formula | C23H37N7O |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.31 |
| IUPAC Name | 1-cyclohexyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-pyrrolidin-1-ylethyl]guanidine |
| SMILES | CCc1nncn1CCN/C(=N\CC(c1ccco1)N1CCCC1)NC1CCCCC1 |
| InChI | InChI=1S/C23H37N7O/c1-2-22-28-26-18-30(22)15-12-24-23(27-19-9-4-3-5-10-19)25-17-20(21-11-8-16-31-21)29-13-6-7-14-29/h8,11,16,18-20H,2-7,9-10,12-15,17H2,1H3,(H2,24,25,27) |
| InChIKey | CQABGMRSYDSQFV-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 83.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|