C23H37N7 — CID 111698617
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]guanidine (PubChem CID 111698617) has the molecular formula C23H37N7 and a molecular weight of 411.60 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]guanidine |
|---|---|
| PubChem CID | 111698617 |
| Molecular Formula | C23H37N7 |
| Molecular Weight | 411.60 g/mol |
| Exact Mass | 411.31 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methylpiperidin-1-yl)-2-phenylethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccccc1)N1CCC(C)CC1)NCCn1cnnc1CC |
| InChI | InChI=1S/C23H37N7/c1-4-22-28-27-18-30(22)16-13-25-23(24-5-2)26-17-21(20-9-7-6-8-10-20)29-14-11-19(3)12-15-29/h6-10,18-19,21H,4-5,11-17H2,1-3H3,(H2,24,25,26) |
| InChIKey | IEIIWUFYTZSXSE-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.60 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|