C21H35N7S — CID 111515885
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine (PubChem CID 111515885) has the molecular formula C21H35N7S and a molecular weight of 417.63 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine |
|---|---|
| PubChem CID | 111515885 |
| Molecular Formula | C21H35N7S |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCC(C)CC1)NCCn1cnnc1CC |
| InChI | InChI=1S/C21H35N7S/c1-4-20-26-25-16-28(20)13-10-23-21(22-5-2)24-15-18(19-7-6-14-29-19)27-11-8-17(3)9-12-27/h6-7,14,16-18H,4-5,8-13,15H2,1-3H3,(H2,22,23,24) |
| InChIKey | TUVHYLLFBCCYRV-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|