C21H34IN7S — CID 136923477
1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylprop-2-enyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 136923477) has the molecular formula C21H34IN7S and a molecular weight of 543.52 g/mol. Its IUPAC name is 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylprop-2-enyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylprop-2-enyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 136923477 |
| Molecular Formula | C21H34IN7S |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 543.16 |
| IUPAC Name | 1-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-3-(2-methylprop-2-enyl)-2-(2-pyrrolidin-1-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C=C(C)CN/C(=N\CC(c1cccs1)N1CCCC1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C21H33N7S.HI/c1-4-20-26-25-16-28(20)12-9-22-21(23-14-17(2)3)24-15-18(19-8-7-13-29-19)27-10-5-6-11-27;/h7-8,13,16,18H,2,4-6,9-12,14-15H2,1,3H3,(H2,22,23,24);1H |
| InChIKey | GHTPOXLGMSRCAN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|