C21H32ClFIN7 — CID 111699018
2-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide (PubChem CID 111699018) has the molecular formula C21H32ClFIN7 and a molecular weight of 563.89 g/mol. Its IUPAC name is 2-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111699018 |
| Molecular Formula | C21H32ClFIN7 |
| Molecular Weight | 563.89 g/mol |
| Exact Mass | 563.14 |
| IUPAC Name | 2-[2-(2-chloro-6-fluorophenyl)-2-pyrrolidin-1-ylethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1c(F)cccc1Cl)N1CCCC1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C21H31ClFN7.HI/c1-3-19-28-27-15-30(19)13-10-25-21(24-4-2)26-14-18(29-11-5-6-12-29)20-16(22)8-7-9-17(20)23;/h7-9,15,18H,3-6,10-14H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | BTCBAPJLAKTVNI-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.89 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|