C17H25ClN6O — CID 111988659
2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111988659) has the molecular formula C17H25ClN6O and a molecular weight of 364.88 g/mol. Its IUPAC name is 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111988659 |
| Molecular Formula | C17H25ClN6O |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-[2-(4-chlorophenyl)-2-hydroxyethyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(Cl)cc1)NCCn1cnnc1CC |
| InChI | InChI=1S/C17H25ClN6O/c1-3-16-23-22-12-24(16)10-9-20-17(19-4-2)21-11-15(25)13-5-7-14(18)8-6-13/h5-8,12,15,25H,3-4,9-11H2,1-2H3,(H2,19,20,21) |
| InChIKey | JDDYPOYZUHZRHF-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|