C15H24N6O2 — CID 111988669
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine (PubChem CID 111988669) has the molecular formula C15H24N6O2 and a molecular weight of 320.40 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine |
|---|---|
| PubChem CID | 111988669 |
| Molecular Formula | C15H24N6O2 |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.20 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccco1)NCCn1cnnc1CC |
| InChI | InChI=1S/C15H24N6O2/c1-3-14-20-19-11-21(14)8-7-17-15(16-4-2)18-10-12(22)13-6-5-9-23-13/h5-6,9,11-12,22H,3-4,7-8,10H2,1-2H3,(H2,16,17,18) |
| InChIKey | QIDQKNSHSOSBEN-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 100.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|