C16H25N7O2 — CID 111700023
2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 111700023) has the molecular formula C16H25N7O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 111700023 |
| Molecular Formula | C16H25N7O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 2-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccco1)NCCn1cnnc1CC |
| InChI | InChI=1S/C16H25N7O2/c1-3-14-22-21-12-23(14)8-7-18-16(17-4-2)20-11-15(24)19-10-13-6-5-9-25-13/h5-6,9,12H,3-4,7-8,10-11H2,1-2H3,(H,19,24)(H2,17,18,20) |
| InChIKey | PWPFZJLTIGNXRD-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 109.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|