C16H27IN6O — CID 111493821
1-tert-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111493821) has the molecular formula C16H27IN6O and a molecular weight of 446.34 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-tert-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111493821 |
| Molecular Formula | C16H27IN6O |
| Molecular Weight | 446.34 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | 1-tert-butyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N/Cc1ccco1)NC(C)(C)C.I |
| InChI | InChI=1S/C16H26N6O.HI/c1-5-14-21-19-12-22(14)9-8-17-15(20-16(2,3)4)18-11-13-7-6-10-23-13;/h6-7,10,12H,5,8-9,11H2,1-4H3,(H2,17,18,20);1H |
| InChIKey | QHNNEQGFBMKDFL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|