C20H34IN7O2 — CID 111515462
3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-(furan-2-ylmethyl)-1-methyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide (PubChem CID 111515462) has the molecular formula C20H34IN7O2 and a molecular weight of 531.44 g/mol. Its IUPAC name is 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-(furan-2-ylmethyl)-1-methyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide.
| Compound Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-(furan-2-ylmethyl)-1-methyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111515462 |
| Molecular Formula | C20H34IN7O2 |
| Molecular Weight | 531.44 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | 3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-1-(furan-2-ylmethyl)-1-methyl-2-(3-morpholin-4-ylpropyl)guanidine;hydroiodide |
| SMILES | CCc1nncn1CCN/C(=N\CCCN1CCOCC1)N(C)Cc1ccco1.I |
| InChI | InChI=1S/C20H33N7O2.HI/c1-3-19-24-23-17-27(19)10-8-22-20(25(2)16-18-6-4-13-29-18)21-7-5-9-26-11-14-28-15-12-26;/h4,6,13,17H,3,5,7-12,14-16H2,1-2H3,(H,21,22);1H |
| InChIKey | HXOPLPDGKBPRCY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|