C14H23IN6O — CID 111491239
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide (PubChem CID 111491239) has the molecular formula C14H23IN6O and a molecular weight of 418.28 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111491239 |
| Molecular Formula | C14H23IN6O |
| Molecular Weight | 418.28 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(furan-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccco1)NCCn1cnnc1CC.I |
| InChI | InChI=1S/C14H22N6O.HI/c1-3-13-19-18-11-20(13)8-7-16-14(15-4-2)17-10-12-6-5-9-21-12;/h5-6,9,11H,3-4,7-8,10H2,1-2H3,(H2,15,16,17);1H |
| InChIKey | DDNSYBOHRUFDQL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 80.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|