C21H35N7 — CID 111699381
2-[[2-(diethylaminomethyl)phenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111699381) has the molecular formula C21H35N7 and a molecular weight of 385.56 g/mol. Its IUPAC name is 2-[[2-(diethylaminomethyl)phenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[[2-(diethylaminomethyl)phenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111699381 |
| Molecular Formula | C21H35N7 |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.30 |
| IUPAC Name | 2-[[2-(diethylaminomethyl)phenyl]methyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccccc1CN(CC)CC)NCCn1cnnc1CC |
| InChI | InChI=1S/C21H35N7/c1-5-20-26-25-17-28(20)14-13-23-21(22-6-2)24-15-18-11-9-10-12-19(18)16-27(7-3)8-4/h9-12,17H,5-8,13-16H2,1-4H3,(H2,22,23,24) |
| InChIKey | OLCMVMGWUUEXQN-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|