C13H22N8 — CID 111698589
1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 111698589) has the molecular formula C13H22N8 and a molecular weight of 290.37 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111698589 |
| Molecular Formula | C13H22N8 |
| Molecular Weight | 290.37 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]-2-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccn[nH]1)NCCn1cnnc1CC |
| InChI | InChI=1S/C13H22N8/c1-3-12-20-18-10-21(12)8-7-15-13(14-4-2)16-9-11-5-6-17-19-11/h5-6,10H,3-4,7-9H2,1-2H3,(H,17,19)(H2,14,15,16) |
| InChIKey | IAGRMGRASGNPIG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.37 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|