C18H31N5O4 — CID 111886201
tert-butyl N-[3-[[N-ethyl-N'-[2-(furan-2-ylmethylamino)-2-oxoethyl]carbamimidoyl]amino]propyl]carbamate (PubChem CID 111886201) has the molecular formula C18H31N5O4 and a molecular weight of 381.48 g/mol. Its IUPAC name is tert-butyl N-[3-[[N-ethyl-N'-[2-(furan-2-ylmethylamino)-2-oxoethyl]carbamimidoyl]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[N-ethyl-N'-[2-(furan-2-ylmethylamino)-2-oxoethyl]carbamimidoyl]amino]propyl]carbamate |
|---|---|
| PubChem CID | 111886201 |
| Molecular Formula | C18H31N5O4 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.24 |
| IUPAC Name | tert-butyl N-[3-[[N-ethyl-N'-[2-(furan-2-ylmethylamino)-2-oxoethyl]carbamimidoyl]amino]propyl]carbamate |
| SMILES | CCN/C(=N\CC(=O)NCc1ccco1)NCCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H31N5O4/c1-5-19-16(20-9-7-10-21-17(25)27-18(2,3)4)23-13-15(24)22-12-14-8-6-11-26-14/h6,8,11H,5,7,9-10,12-13H2,1-4H3,(H,21,25)(H,22,24)(H2,19,20,23) |
| InChIKey | LRWCBGLWXCOWOJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 116.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|