C18H33IN4O2 — CID 111127674
2-[[ethylamino-(2-ethylhexylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide (PubChem CID 111127674) has the molecular formula C18H33IN4O2 and a molecular weight of 464.39 g/mol. Its IUPAC name is 2-[[ethylamino-(2-ethylhexylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-(2-ethylhexylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111127674 |
| Molecular Formula | C18H33IN4O2 |
| Molecular Weight | 464.39 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | 2-[[ethylamino-(2-ethylhexylamino)methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
| SMILES | CCCCC(CC)CN/C(=N/CC(=O)NCc1ccco1)NCC.I |
| InChI | InChI=1S/C18H32N4O2.HI/c1-4-7-9-15(5-2)12-21-18(19-6-3)22-14-17(23)20-13-16-10-8-11-24-16;/h8,10-11,15H,4-7,9,12-14H2,1-3H3,(H,20,23)(H2,19,21,22);1H |
| InChIKey | KYZLJVUMYCWXRK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|