C23H34IN5O3 — CID 111322837
2-[[ethylamino-[[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide (PubChem CID 111322837) has the molecular formula C23H34IN5O3 and a molecular weight of 555.46 g/mol. Its IUPAC name is 2-[[ethylamino-[[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111322837 |
| Molecular Formula | C23H34IN5O3 |
| Molecular Weight | 555.46 g/mol |
| Exact Mass | 555.17 |
| IUPAC Name | 2-[[ethylamino-[[2-(2-methoxyphenyl)-2-pyrrolidin-1-ylethyl]amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccco1)NCC(c1ccccc1OC)N1CCCC1.I |
| InChI | InChI=1S/C23H33N5O3.HI/c1-3-24-23(27-17-22(29)25-15-18-9-8-14-31-18)26-16-20(28-12-6-7-13-28)19-10-4-5-11-21(19)30-2;/h4-5,8-11,14,20H,3,6-7,12-13,15-17H2,1-2H3,(H,25,29)(H2,24,26,27);1H |
| InChIKey | UAYYOWUNZJRWEE-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|