C23H34IN5O4 — CID 111309755
2-[[ethylamino-[[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide (PubChem CID 111309755) has the molecular formula C23H34IN5O4 and a molecular weight of 571.46 g/mol. Its IUPAC name is 2-[[ethylamino-[[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111309755 |
| Molecular Formula | C23H34IN5O4 |
| Molecular Weight | 571.46 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | 2-[[ethylamino-[[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccco1)NCC(c1ccc(OC)cc1)N1CCOCC1.I |
| InChI | InChI=1S/C23H33N5O4.HI/c1-3-24-23(27-17-22(29)25-15-20-5-4-12-32-20)26-16-21(28-10-13-31-14-11-28)18-6-8-19(30-2)9-7-18;/h4-9,12,21H,3,10-11,13-17H2,1-2H3,(H,25,29)(H2,24,26,27);1H |
| InChIKey | ZRVYPEWAPFGIQN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.46 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|