C20H29N5O3S — CID 111284411
2-[[ethylamino-[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide (PubChem CID 111284411) has the molecular formula C20H29N5O3S and a molecular weight of 419.55 g/mol. Its IUPAC name is 2-[[ethylamino-[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide.
| Compound Name | 2-[[ethylamino-[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 111284411 |
| Molecular Formula | C20H29N5O3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-[[ethylamino-[(2-morpholin-4-yl-2-thiophen-2-ylethyl)amino]methylidene]amino]-N-(furan-2-ylmethyl)acetamide |
| SMILES | CCN/C(=N\CC(=O)NCc1ccco1)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C20H29N5O3S/c1-2-21-20(24-15-19(26)22-13-16-5-3-9-28-16)23-14-17(18-6-4-12-29-18)25-7-10-27-11-8-25/h3-6,9,12,17H,2,7-8,10-11,13-15H2,1H3,(H,22,26)(H2,21,23,24) |
| InChIKey | FYELGJZNZVNKFL-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|