C23H37N5O2S — CID 111283453
1-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111283453) has the molecular formula C23H37N5O2S and a molecular weight of 447.65 g/mol. Its IUPAC name is 1-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111283453 |
| Molecular Formula | C23H37N5O2S |
| Molecular Weight | 447.65 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 1-[2-(diethylamino)-2-(furan-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCC(c1ccco1)N(CC)CC |
| InChI | InChI=1S/C23H37N5O2S/c1-4-24-23(25-17-19(27(5-2)6-3)21-9-7-13-30-21)26-18-20(22-10-8-16-31-22)28-11-14-29-15-12-28/h7-10,13,16,19-20H,4-6,11-12,14-15,17-18H2,1-3H3,(H2,24,25,26) |
| InChIKey | BMLHJUVEHPYQES-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 65.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.65 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|