C19H28IN5O3S — CID 111284264
N-(furan-2-ylmethyl)-2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111284264) has the molecular formula C19H28IN5O3S and a molecular weight of 533.44 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-(furan-2-ylmethyl)-2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111284264 |
| Molecular Formula | C19H28IN5O3S |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NCc1ccco1)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C19H27N5O3S.HI/c1-20-19(23-14-18(25)21-12-15-4-2-8-27-15)22-13-16(17-5-3-11-28-17)24-6-9-26-10-7-24;/h2-5,8,11,16H,6-7,9-10,12-14H2,1H3,(H,21,25)(H2,20,22,23);1H |
| InChIKey | ZPOMBIAJECIZJD-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|