C22H31N5O3S — CID 111284159
N-[(4-methoxyphenyl)methyl]-2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide (PubChem CID 111284159) has the molecular formula C22H31N5O3S and a molecular weight of 445.59 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide.
| Compound Name | N-[(4-methoxyphenyl)methyl]-2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide |
|---|---|
| PubChem CID | 111284159 |
| Molecular Formula | C22H31N5O3S |
| Molecular Weight | 445.59 g/mol |
| Exact Mass | 445.21 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]acetamide |
| SMILES | C/N=C(/NCC(=O)NCc1ccc(OC)cc1)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C22H31N5O3S/c1-23-22(26-16-21(28)24-14-17-5-7-18(29-2)8-6-17)25-15-19(20-4-3-13-31-20)27-9-11-30-12-10-27/h3-8,13,19H,9-12,14-16H2,1-2H3,(H,24,28)(H2,23,25,26) |
| InChIKey | WHBACUNGNBOVDE-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.59 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|