C22H32IN5O2S — CID 111284188
2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide (PubChem CID 111284188) has the molecular formula C22H32IN5O2S and a molecular weight of 557.50 g/mol. Its IUPAC name is 2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide.
| Compound Name | 2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide |
|---|---|
| PubChem CID | 111284188 |
| Molecular Formula | C22H32IN5O2S |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 2-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-(2-phenylethyl)acetamide;hydroiodide |
| SMILES | C/N=C(\NCC(=O)NCCc1ccccc1)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C22H31N5O2S.HI/c1-23-22(26-17-21(28)24-10-9-18-6-3-2-4-7-18)25-16-19(20-8-5-15-30-20)27-11-13-29-14-12-27;/h2-8,15,19H,9-14,16-17H2,1H3,(H,24,28)(H2,23,25,26);1H |
| InChIKey | IYDIMAIGDUXXKD-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|