C21H35N5O3 — CID 111309840
2-[[ethylamino-[[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N-propylacetamide (PubChem CID 111309840) has the molecular formula C21H35N5O3 and a molecular weight of 405.54 g/mol. Its IUPAC name is 2-[[ethylamino-[[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N-propylacetamide.
| Compound Name | 2-[[ethylamino-[[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N-propylacetamide |
|---|---|
| PubChem CID | 111309840 |
| Molecular Formula | C21H35N5O3 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | 2-[[ethylamino-[[2-(4-methoxyphenyl)-2-morpholin-4-ylethyl]amino]methylidene]amino]-N-propylacetamide |
| SMILES | CCCNC(=O)C/N=C(\NCC)NCC(c1ccc(OC)cc1)N1CCOCC1 |
| InChI | InChI=1S/C21H35N5O3/c1-4-10-23-20(27)16-25-21(22-5-2)24-15-19(26-11-13-29-14-12-26)17-6-8-18(28-3)9-7-17/h6-9,19H,4-5,10-16H2,1-3H3,(H,23,27)(H2,22,24,25) |
| InChIKey | TZBGZURHYODSRS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|