C13H24IN3O2 — CID 111152199
1-butyl-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide (PubChem CID 111152199) has the molecular formula C13H24IN3O2 and a molecular weight of 381.26 g/mol. Its IUPAC name is 1-butyl-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111152199 |
| Molecular Formula | C13H24IN3O2 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 1-butyl-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(=N/CC(O)c1ccco1)NCC.I |
| InChI | InChI=1S/C13H23N3O2.HI/c1-3-5-8-15-13(14-4-2)16-10-11(17)12-7-6-9-18-12;/h6-7,9,11,17H,3-5,8,10H2,1-2H3,(H2,14,15,16);1H |
| InChIKey | BDJPDTUOQQVGML-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|