C17H23ClIN3O2 — CID 111358575
1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide (PubChem CID 111358575) has the molecular formula C17H23ClIN3O2 and a molecular weight of 463.75 g/mol. Its IUPAC name is 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111358575 |
| Molecular Formula | C17H23ClIN3O2 |
| Molecular Weight | 463.75 g/mol |
| Exact Mass | 463.05 |
| IUPAC Name | 1-[2-(3-chlorophenyl)ethyl]-3-ethyl-2-[2-(furan-2-yl)-2-hydroxyethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(O)c1ccco1)NCCc1cccc(Cl)c1.I |
| InChI | InChI=1S/C17H22ClN3O2.HI/c1-2-19-17(21-12-15(22)16-7-4-10-23-16)20-9-8-13-5-3-6-14(18)11-13;/h3-7,10-11,15,22H,2,8-9,12H2,1H3,(H2,19,20,21);1H |
| InChIKey | CYCFLVAYRZDSRH-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 69.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.75 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|