C19H28ClN7O — CID 111699551
N-(4-chlorophenyl)-4-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]butanamide (PubChem CID 111699551) has the molecular formula C19H28ClN7O and a molecular weight of 405.93 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]butanamide.
| Compound Name | N-(4-chlorophenyl)-4-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]butanamide |
|---|---|
| PubChem CID | 111699551 |
| Molecular Formula | C19H28ClN7O |
| Molecular Weight | 405.93 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | N-(4-chlorophenyl)-4-[[ethylamino-[2-(3-ethyl-1,2,4-triazol-4-yl)ethylamino]methylidene]amino]butanamide |
| SMILES | CCN/C(=N\CCCC(=O)Nc1ccc(Cl)cc1)NCCn1cnnc1CC |
| InChI | InChI=1S/C19H28ClN7O/c1-3-17-26-24-14-27(17)13-12-23-19(21-4-2)22-11-5-6-18(28)25-16-9-7-15(20)8-10-16/h7-10,14H,3-6,11-13H2,1-2H3,(H,25,28)(H2,21,22,23) |
| InChIKey | NDAHKHWUCHQPKI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 96.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.93 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|