C19H29ClIN5O2 — CID 111928121
N-[2-[[N'-[4-(4-chloroanilino)-4-oxobutyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide (PubChem CID 111928121) has the molecular formula C19H29ClIN5O2 and a molecular weight of 521.83 g/mol. Its IUPAC name is N-[2-[[N'-[4-(4-chloroanilino)-4-oxobutyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide.
| Compound Name | N-[2-[[N'-[4-(4-chloroanilino)-4-oxobutyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
|---|---|
| PubChem CID | 111928121 |
| Molecular Formula | C19H29ClIN5O2 |
| Molecular Weight | 521.83 g/mol |
| Exact Mass | 521.11 |
| IUPAC Name | N-[2-[[N'-[4-(4-chloroanilino)-4-oxobutyl]-N-ethylcarbamimidoyl]amino]ethyl]cyclopropanecarboxamide;hydroiodide |
| SMILES | CCN/C(=N\CCCC(=O)Nc1ccc(Cl)cc1)NCCNC(=O)C1CC1.I |
| InChI | InChI=1S/C19H28ClN5O2.HI/c1-2-21-19(24-13-12-22-18(27)14-5-6-14)23-11-3-4-17(26)25-16-9-7-15(20)8-10-16;/h7-10,14H,2-6,11-13H2,1H3,(H,22,27)(H,25,26)(H2,21,23,24);1H |
| InChIKey | OLDRFWCWCHZBAJ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 94.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.83 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|