C21H33ClIN5O3 — CID 111327517
ethyl 4-[[N'-[4-(4-chloroanilino)-4-oxobutyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide (PubChem CID 111327517) has the molecular formula C21H33ClIN5O3 and a molecular weight of 565.88 g/mol. Its IUPAC name is ethyl 4-[[N'-[4-(4-chloroanilino)-4-oxobutyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[[N'-[4-(4-chloroanilino)-4-oxobutyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 111327517 |
| Molecular Formula | C21H33ClIN5O3 |
| Molecular Weight | 565.88 g/mol |
| Exact Mass | 565.13 |
| IUPAC Name | ethyl 4-[[N'-[4-(4-chloroanilino)-4-oxobutyl]-N-ethylcarbamimidoyl]amino]piperidine-1-carboxylate;hydroiodide |
| SMILES | CCN/C(=N\CCCC(=O)Nc1ccc(Cl)cc1)NC1CCN(C(=O)OCC)CC1.I |
| InChI | InChI=1S/C21H32ClN5O3.HI/c1-3-23-20(26-18-11-14-27(15-12-18)21(29)30-4-2)24-13-5-6-19(28)25-17-9-7-16(22)8-10-17;/h7-10,18H,3-6,11-15H2,1-2H3,(H,25,28)(H2,23,24,26);1H |
| InChIKey | LUBDSLVCHSDWEB-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.88 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|