C22H35N7 — CID 111701159
2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine (PubChem CID 111701159) has the molecular formula C22H35N7 and a molecular weight of 397.57 g/mol. Its IUPAC name is 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine.
| Compound Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111701159 |
| Molecular Formula | C22H35N7 |
| Molecular Weight | 397.57 g/mol |
| Exact Mass | 397.30 |
| IUPAC Name | 2-[2-(3,4-dihydro-1H-isoquinolin-2-yl)butyl]-1-ethyl-3-[2-(3-ethyl-1,2,4-triazol-4-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CC(CC)N1CCc2ccccc2C1)NCCn1cnnc1CC |
| InChI | InChI=1S/C22H35N7/c1-4-20(28-13-11-18-9-7-8-10-19(18)16-28)15-25-22(23-6-3)24-12-14-29-17-26-27-21(29)5-2/h7-10,17,20H,4-6,11-16H2,1-3H3,(H2,23,24,25) |
| InChIKey | VOZGWJNCQZPEBI-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.57 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|