C17H28N4O2 — CID 47083229
2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-(oxolan-2-ylmethyl)guanidine (PubChem CID 47083229) has the molecular formula C17H28N4O2 and a molecular weight of 320.44 g/mol. Its IUPAC name is 2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-(oxolan-2-ylmethyl)guanidine.
| Compound Name | 2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-(oxolan-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 47083229 |
| Molecular Formula | C17H28N4O2 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 2-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-1-(oxolan-2-ylmethyl)guanidine |
| SMILES | N/C(=N\CC(c1ccco1)N1CCCCC1)NCC1CCCO1 |
| InChI | InChI=1S/C17H28N4O2/c18-17(19-12-14-6-4-10-22-14)20-13-15(16-7-5-11-23-16)21-8-2-1-3-9-21/h5,7,11,14-15H,1-4,6,8-10,12-13H2,(H3,18,19,20) |
| InChIKey | NJZDVKRTMBPIQL-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|